|
CAS#: 680-52-4 Product: Pentachloro-3-Butenoyl Chloride No suppilers available for the product. |
| Name | Pentachloro-3-Butenoyl Chloride |
|---|---|
| Synonyms | 3-Butenoyl Chloride, 2,2,3,4,4-Pentachloro-; 4-02-00-01497 (Beilstein Handbook Reference); Brn 1709421 |
| Molecular Structure | ![]() |
| Molecular Formula | C4Cl6O |
| Molecular Weight | 276.76 |
| CAS Registry Number | 680-52-4 |
| SMILES | O=C(C(C(=C(Cl)Cl)Cl)(Cl)Cl)Cl |
| InChI | 1S/C4Cl6O/c5-1(2(6)7)4(9,10)3(8)11 |
| InChIKey | YWBSILUOCLPVTI-UHFFFAOYSA-N |
| Density | 1.806g/cm3 (Cal.) |
|---|---|
| Boiling point | 220.598°C at 760 mmHg (Cal.) |
| Flash point | 88.405°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Pentachloro-3-Butenoyl Chloride |