|
CAS#: 68084-50-4 Product: Dihydromethyl-alpha-Ionone No suppilers available for the product. |
| Name | Dihydromethyl-alpha-Ionone |
|---|---|
| Synonyms | 1-Penten-3-One, 1-(2,6,6-Trimethyl-2-Cyclohexen-1-Yl)-, Dihydro Deriv.; Alpha-Methylionone, Hydrogenated |
| Molecular Structure | ![]() |
| Molecular Formula | C14H24O |
| Molecular Weight | 208.34 |
| CAS Registry Number | 68084-50-4 |
| SMILES | C(C(/C=C/C1C(C)(C)CCCC1C)=O)C |
| InChI | 1S/C14H24O/c1-5-12(15)8-9-13-11(2)7-6-10-14(13,3)4/h8-9,11,13H,5-7,10H2,1-4H3/b9-8+ |
| InChIKey | HFILTWMNPDNKCT-CMDGGOBGSA-N |
| Density | 0.902g/cm3 (Cal.) |
|---|---|
| Boiling point | 283.369°C at 760 mmHg (Cal.) |
| Flash point | 121.009°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Dihydromethyl-alpha-Ionone |