|
CAS#: 68227-97-4 Product: 4-[Methyl[(Pentadecafluoroheptyl)Sulphonyl]Amino]Butyl Acrylate No suppilers available for the product. |
| Name | 4-[Methyl[(Pentadecafluoroheptyl)Sulphonyl]Amino]Butyl Acrylate |
|---|---|
| Synonyms | Prop-2-Enoic Acid 4-(Methyl-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-Pentadecafluoroheptylsulfonyl)Amino)Butyl Ester; Acrylic Acid 4-(Methyl-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-Pentadecafluoroheptylsulfonyl)Amino)Butyl Ester; 2-Propenoic Acid, 4-(Methyl((Pentadecafluoroheptyl)Sulfonyl)Amino)Butyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C15H14F15NO4S |
| Molecular Weight | 589.32 |
| CAS Registry Number | 68227-97-4 |
| EINECS | 269-393-6 |
| SMILES | C(N([S](=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C)CCCOC(=O)C=C |
| InChI | 1S/C15H14F15NO4S/c1-3-8(32)35-7-5-4-6-31(2)36(33,34)15(29,30)13(24,25)11(20,21)9(16,17)10(18,19)12(22,23)14(26,27)28/h3H,1,4-7H2,2H3 |
| InChIKey | XOBAFFLCNWEIRZ-UHFFFAOYSA-N |
| Density | 1.53g/cm3 (Cal.) |
|---|---|
| Boiling point | 366.356°C at 760 mmHg (Cal.) |
| Flash point | 175.366°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-[Methyl[(Pentadecafluoroheptyl)Sulphonyl]Amino]Butyl Acrylate |