Online Database of Chemicals from Around the World
| Name | Heptadecafluoro-N-(4-Hydroxybutyl)-N-Methyloctanesulphonamide |
|---|---|
| Synonyms | 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-Heptadecafluoro-N-(4-Hydroxybutyl)-N-Methyl-Octane-1-Sulfonamide; 1-Octanesulfonamide, 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-Heptadecafluoro-N-(4-Hydroxybutyl)-N-Methyl- |
| Molecular Structure |  |
| Molecular Formula | C13H12F17NO3S |
| Molecular Weight | 585.28 |
| CAS Registry Number | 68239-73-6 |
| EINECS | 269-466-2 |
| SMILES | C(N([S](=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C)CCCO |
| InChI | 1S/C13H12F17NO3S/c1-31(4-2-3-5-32)35(33,34)13(29,30)11(24,25)9(20,21)7(16,17)6(14,15)8(18,19)10(22,23)12(26,27)28/h32H,2-5H2,1H3 |
| InChIKey | IARCBLTVLGDOGQ-UHFFFAOYSA-N |
| Density | 1.617g/cm3 (Cal.) |
|---|---|
| Boiling point | 335.209°C at 760 mmHg (Cal.) |
| Flash point | 156.529°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Heptadecafluoro-N-(4-Hydroxybutyl)-N-Methyloctanesulphonamide |
