|
CAS#: 68555-33-9 Product: 4,4,6-Trimethyl-2-[4-(1-Methylethyl)Phenyl]-1,3-Dioxane No suppilers available for the product. |
| Name | 4,4,6-Trimethyl-2-[4-(1-Methylethyl)Phenyl]-1,3-Dioxane |
|---|---|
| Synonyms | 2-(4-Isopropylphenyl)-4,4,6-Trimethyl-1,3-Dioxane; 1,3-Dioxane, 4,4,6-Trimethyl-2-[4-(1-Methylethyl)Phenyl]-; Nsc50324 |
| Molecular Structure | ![]() |
| Molecular Formula | C16H24O2 |
| Molecular Weight | 248.36 |
| CAS Registry Number | 68555-33-9 |
| EINECS | 271-424-3 |
| SMILES | C1=C(C=CC(=C1)C2OC(CC(O2)C)(C)C)C(C)C |
| InChI | 1S/C16H24O2/c1-11(2)13-6-8-14(9-7-13)15-17-12(3)10-16(4,5)18-15/h6-9,11-12,15H,10H2,1-5H3 |
| InChIKey | PDVNVZULPFBIIB-UHFFFAOYSA-N |
| Density | 0.951g/cm3 (Cal.) |
|---|---|
| Boiling point | 324.149°C at 760 mmHg (Cal.) |
| Flash point | 161.571°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4,4,6-Trimethyl-2-[4-(1-Methylethyl)Phenyl]-1,3-Dioxane |