|
CAS#: 68555-55-5 Product: 1,1'-(Sulphonyldi-3,1-Phenylene)Bis-1H-Pyrrole-2,5-Dione No suppilers available for the product. |
| Name | 1,1'-(Sulphonyldi-3,1-Phenylene)Bis-1H-Pyrrole-2,5-Dione |
|---|---|
| Synonyms | 1-[3-[3-(2,5-Dioxo-1-Pyrrolyl)Phenyl]Sulfonylphenyl]Pyrrole-2,5-Dione; 1-[3-(3-Maleimidophenyl)Sulfonylphenyl]-3-Pyrroline-2,5-Quinone; 1,1'-(Sulphonyldi-3,1-Phenylene)Bis-1H-Pyrrole-2,5-Dione |
| Molecular Structure | ![]() |
| Molecular Formula | C20H12N2O6S |
| Molecular Weight | 408.38 |
| CAS Registry Number | 68555-55-5 |
| EINECS | 271-431-1 |
| SMILES | C3=C([S](C1=CC(=CC=C1)N2C(C=CC2=O)=O)(=O)=O)C=CC=C3N4C(C=CC4=O)=O |
| InChI | 1S/C20H12N2O6S/c23-17-7-8-18(24)21(17)13-3-1-5-15(11-13)29(27,28)16-6-2-4-14(12-16)22-19(25)9-10-20(22)26/h1-12H |
| InChIKey | RNSJLHIBGRARKK-UHFFFAOYSA-N |
| Density | 1.574g/cm3 (Cal.) |
|---|---|
| Boiling point | 686.981°C at 760 mmHg (Cal.) |
| Flash point | 369.273°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,1'-(Sulphonyldi-3,1-Phenylene)Bis-1H-Pyrrole-2,5-Dione |