|
CAS#: 68555-66-8 Product: Sodium 1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-Pentadecafluoroheptane-1-Sulphinate No suppilers available for the product. |
| Name | Sodium 1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-Pentadecafluoroheptane-1-Sulphinate |
|---|---|
| Synonyms | 1-Heptanesulfinic Acid, 1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-Pentadecafluoro-, Sodium Salt; Sodium 1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-Pentadecafluoroheptane-1-Sulphinate |
| Molecular Structure | ![]() |
| Molecular Formula | C7F15NaO2S |
| Molecular Weight | 456.10 |
| CAS Registry Number | 68555-66-8 |
| EINECS | 271-443-7 |
| SMILES | O=[S]([O-])C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F.[Na+] |
| InChI | 1S/C7HF15O2S.Na/c8-1(9,2(10,11)4(14,15)6(18,19)20)3(12,13)5(16,17)7(21,22)25(23)24;/h(H,23,24);/q;+1/p-1 |
| InChIKey | OEIUCKZRGRKVRL-UHFFFAOYSA-M |
| Boiling point | 208.5°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 79.9°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Sodium 1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-Pentadecafluoroheptane-1-Sulphinate |