|
CAS#: 68958-22-5 Product: 4-Tert-Butylphenol-Epichlorohydrin Polymer No suppilers available for the product. |
| Name | 4-Tert-Butylphenol-Epichlorohydrin Polymer |
|---|---|
| Synonyms | Phenol, 4-(1,1-Dimethylethyl)-, Polymer With (Chloromethyl)Oxirane |
| Molecular Formula | C13H19ClO2 |
| Molecular Weight | 242.74 |
| CAS Registry Number | 68958-22-5 |
| SMILES | C(Cl)C1OC1.C2=C(C(C)(C)C)C=CC(=C2)O |
| InChI | 1S/C10H14O.C3H5ClO/c1-10(2,3)8-4-6-9(11)7-5-8;4-1-3-2-5-3/h4-7,11H,1-3H3;3H,1-2H2 |
| InChIKey | PTEFQGASMHCERV-UHFFFAOYSA-N |
| Boiling point | 233.7°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 110.9°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Tert-Butylphenol-Epichlorohydrin Polymer |