|
CAS#: 69381-99-3 Product: Basic Violet 10 No suppilers available for the product. |
| Name | Basic Violet 10 |
|---|---|
| Synonyms | 2-Cyclohexyl-2-[(2E)-3,7-Dimethylocta-2,6-Dienyl]Malonic Acid; 2-Cyclohexyl-2-Geranylmalonic Acid; Propanedioic Acid, Cyclohexyl(3,7-Dimethyl-2,6-Octadienyl)-, (E)- |
| Molecular Structure | ![]() |
| Molecular Formula | C19H30O4 |
| Molecular Weight | 322.44 |
| CAS Registry Number | 69381-99-3 |
| SMILES | C(C(C1CCCCC1)(C(=O)O)C(=O)O)\C=C(\CCC=C(C)C)C |
| InChI | 1S/C19H30O4/c1-14(2)8-7-9-15(3)12-13-19(17(20)21,18(22)23)16-10-5-4-6-11-16/h8,12,16H,4-7,9-11,13H2,1-3H3,(H,20,21)(H,22,23)/b15-12+ |
| InChIKey | RWZTZYGOHTYHLY-NTCAYCPXSA-N |
| Density | 1.084g/cm3 (Cal.) |
|---|---|
| Boiling point | 503.194°C at 760 mmHg (Cal.) |
| Flash point | 272.215°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Basic Violet 10 |