|
CAS#: 69466-64-4 Product: 3-Ethoxy-5-Phenyl-1,2,4-Triazine No suppilers available for the product. |
| Name | 3-Ethoxy-5-Phenyl-1,2,4-Triazine |
|---|---|
| Synonyms | 1,2,4-Triazine, 3-Ethoxy-5-Phenyl-; 3-Ethoxy-5-Phenyl-As-Triazine; Brn 0644563 |
| Molecular Structure | ![]() |
| Molecular Formula | C11H11N3O |
| Molecular Weight | 201.23 |
| CAS Registry Number | 69466-64-4 |
| SMILES | C1=C(N=C(N=N1)OCC)C2=CC=CC=C2 |
| InChI | 1S/C11H11N3O/c1-2-15-11-13-10(8-12-14-11)9-6-4-3-5-7-9/h3-8H,2H2,1H3 |
| InChIKey | NPVKLMWFLRCRFP-UHFFFAOYSA-N |
| Density | 1.15g/cm3 (Cal.) |
|---|---|
| Boiling point | 367.346°C at 760 mmHg (Cal.) |
| Flash point | 133.901°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Ethoxy-5-Phenyl-1,2,4-Triazine |