|
CAS#: 69466-69-9 Product: 3-Methoxy-5-(1-Naphtyl)-1,2,4-Triazine No suppilers available for the product. |
| Name | 3-Methoxy-5-(1-Naphtyl)-1,2,4-Triazine |
|---|---|
| Synonyms | 3-Methoxy-5-(1-Naphthyl)-1,2,4-Triazine; As-Triazine, 3-Methoxy-5-(1-Naphthyl)-; 1,2,4-Triazine, 3-Methoxy-5-(1-Naphthalenyl)- |
| Molecular Structure | ![]() |
| Molecular Formula | C14H11N3O |
| Molecular Weight | 237.26 |
| CAS Registry Number | 69466-69-9 |
| SMILES | C1=C(N=C(N=N1)OC)C2=C3C(=CC=C2)C=CC=C3 |
| InChI | 1S/C14H11N3O/c1-18-14-16-13(9-15-17-14)12-8-4-6-10-5-2-3-7-11(10)12/h2-9H,1H3 |
| InChIKey | JADURWQFGBKBFI-UHFFFAOYSA-N |
| Density | 1.232g/cm3 (Cal.) |
|---|---|
| Boiling point | 425.686°C at 760 mmHg (Cal.) |
| Flash point | 153.577°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Methoxy-5-(1-Naphtyl)-1,2,4-Triazine |