|
CAS#: 70008-54-7 Product: N,N-Bis(Phosphonomethyl)-L-Aspartic Acid No suppilers available for the product. |
| Name | N,N-Bis(Phosphonomethyl)-L-Aspartic Acid |
|---|---|
| Synonyms | 2-(Bis(Phosphonomethyl)Amino)Succinic Acid; L-Aspartic Acid, N,N-Bis(Phosphonomethyl)- |
| Molecular Structure | ![]() |
| Molecular Formula | C6H13NO10P2 |
| Molecular Weight | 321.12 |
| CAS Registry Number | 70008-54-7 |
| SMILES | C([P](=O)(O)O)N(C[P](=O)(O)O)C(C(=O)O)CC(=O)O |
| InChI | 1S/C6H13NO10P2/c8-5(9)1-4(6(10)11)7(2-18(12,13)14)3-19(15,16)17/h4H,1-3H2,(H,8,9)(H,10,11)(H2,12,13,14)(H2,15,16,17) |
| InChIKey | HHYWZGRWGMVMPK-UHFFFAOYSA-N |
| Density | 1.973g/cm3 (Cal.) |
|---|---|
| Boiling point | 677.726°C at 760 mmHg (Cal.) |
| Flash point | 363.676°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N,N-Bis(Phosphonomethyl)-L-Aspartic Acid |