|
CAS#: 7008-15-3 Product: Hydroxindasol No suppilers available for the product. |
| Name | Hydroxindasol |
|---|---|
| Synonyms | 3-(2-Aminoethyl)-1-[(4-Methoxyphenyl)Methyl]-2-Methyl-Indol-5-Ol; 3-(2-Aminoethyl)-1-[(4-Methoxyphenyl)Methyl]-2-Methyl-5-Indolol; 3-(2-Aminoethyl)-1-(4-Methoxybenzyl)-2-Methyl-Indol-5-Ol |
| Molecular Structure | ![]() |
| Molecular Formula | C19H22N2O2 |
| Molecular Weight | 310.40 |
| CAS Registry Number | 7008-15-3 |
| SMILES | C1=C(O)C=CC2=C1C(=C(C)[N]2CC3=CC=C(OC)C=C3)CCN |
| InChI | 1S/C19H22N2O2/c1-13-17(9-10-20)18-11-15(22)5-8-19(18)21(13)12-14-3-6-16(23-2)7-4-14/h3-8,11,22H,9-10,12,20H2,1-2H3 |
| InChIKey | AYYHIZJKRIKWCE-UHFFFAOYSA-N |
| Density | 1.182g/cm3 (Cal.) |
|---|---|
| Boiling point | 546.943°C at 760 mmHg (Cal.) |
| Flash point | 284.581°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Hydroxindasol |