|
CAS#: 70170-72-8 Product: 11-Nortetrodotoxin No suppilers available for the product. |
| Name | 11-Nortetrodotoxin |
|---|---|
| Synonyms | C(11)-Nortetrodotoxin; Nor-Ttx; Tetrodotoxin, 6-De(Hydroxymethyl)-6-Deoxy-6-Oxo- |
| Molecular Structure | ![]() |
| Molecular Formula | C10H13N3O7 |
| Molecular Weight | 287.23 |
| CAS Registry Number | 70170-72-8 |
| SMILES | O=C1C2OC4(OC1C(O)C3(NC(=NC(O)C23)N)C4O)O |
| InChI | 1S/C10H13N3O7/c11-8-12-6(16)1-3-2(14)4-5(15)9(1,13-8)7(17)10(18,19-3)20-4/h1,3-7,15-18H,(H3,11,12,13) |
| InChIKey | UMMRDVHXDFCFAA-UHFFFAOYSA-N |
| Density | 2.994g/cm3 (Cal.) |
|---|---|
| Boiling point | 722.281°C at 760 mmHg (Cal.) |
| Flash point | 390.621°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 11-Nortetrodotoxin |