| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| International Laboratory Limited | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (650) 278-9963 | |||
![]() |
admin@intlab.org | |||
| Chemical manufacturer since 2002 | ||||
| TimTec | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (302) 292-8500 | |||
![]() |
info@timtec.com | |||
| Chemical manufacturer | ||||
| Classification | Analytical chemistry >> Standard >> Pesticides, veterinary drugs and fertilizers |
|---|---|
| Name | Diniconazole |
| Synonyms | (E)-1-(2,4-Dichlorophenyl)-4,4-Dimethyl-2-(1,2,4-Triazol-1-Yl)Pent-1-En-3-Ol; 1H-1,2,4-Triazole-1-Ethanol, Beta-((2,4-Dichlorophenyl)Methylene)-Alpha-(1,1-Dimethylethyl)-, (Betae)-; Diniconazole |
| Molecular Structure | ![]() |
| Molecular Formula | C15H17Cl2N3O |
| Molecular Weight | 326.22 |
| CAS Registry Number | 70217-36-6 |
| SMILES | C1=CC(=CC(=C1\C=C(/C(C(C)(C)C)O)[N]2C=NC=N2)Cl)Cl |
| InChI | 1S/C15H17Cl2N3O/c1-15(2,3)14(21)13(20-9-18-8-19-20)6-10-4-5-11(16)7-12(10)17/h4-9,14,21H,1-3H3/b13-6+ |
| InChIKey | FBOUIAKEJMZPQG-AWNIVKPZSA-N |
| Density | 1.3±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 501.1±60.0°C at 760 mmHg (Cal.) |
| Flash point | 256.8±32.9°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Diniconazole |