|
CAS#: 70222-88-7 Product: (R)-1,3,3-Trimethyl-2-Oxabicyclo[2.2.2]Octan-6-One No suppilers available for the product. |
| Name | (R)-1,3,3-Trimethyl-2-Oxabicyclo[2.2.2]Octan-6-One |
|---|---|
| Synonyms | Lmpr01020020; 1,3,3-Trimethyl-2-Oxabicyclo[2.2.2]Octan-6-One |
| Molecular Structure | ![]() |
| Molecular Formula | C10H16O2 |
| Molecular Weight | 168.24 |
| CAS Registry Number | 70222-88-7 |
| EINECS | 274-451-9 |
| SMILES | CC1(C2CC(=O)C(O1)(CC2)C)C |
| InChI | 1S/C10H16O2/c1-9(2)7-4-5-10(3,12-9)8(11)6-7/h7H,4-6H2,1-3H3 |
| InChIKey | CCBAAZXPXFYPBE-UHFFFAOYSA-N |
| Density | 1.028g/cm3 (Cal.) |
|---|---|
| Boiling point | 230.56°C at 760 mmHg (Cal.) |
| Flash point | 87.133°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (R)-1,3,3-Trimethyl-2-Oxabicyclo[2.2.2]Octan-6-One |