|
CAS#: 70519-09-4 Product: Isooctanoic Acid Iron Salt No suppilers available for the product. |
| Name | Isooctanoic Acid Iron Salt |
|---|---|
| Synonyms | Ferric 6-Methylheptanoate; Ferric 6-Methylenanthate |
| Molecular Structure | ![]() |
| Molecular Formula | C8H15FeO2 |
| Molecular Weight | 199.05 |
| CAS Registry Number | 70519-09-4 |
| EINECS | 274-642-7 |
| SMILES | C(C([O-])=O)CCCC(C)C.[Fe+3] |
| InChI | 1S/C8H16O2.Fe/c1-7(2)5-3-4-6-8(9)10;/h7H,3-6H2,1-2H3,(H,9,10);/q;+3/p-1 |
| InChIKey | WRNIELBRQAQHEV-UHFFFAOYSA-M |
| Boiling point | 234.6°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 116.6°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Isooctanoic Acid Iron Salt |