|
CAS#: 70729-59-8 Product: 6,7-Dichloro-1,4-bis((4-methylphenyl)amino)anthraquinone No suppilers available for the product. |
| Name | 6,7-Dichloro-1,4-bis((4-methylphenyl)amino)anthraquinone |
|---|---|
| Synonyms | 6,7-Dichloro-1,4-Bis[(4-Methylphenyl)Amino]-9,10-Anthraquinone; 6,7-Dichloro-1,4-Bis((4-Methylphenyl)Amino)Anthraquinone; 6,7-Dichloro-1,4-Bis-(4-Toluidino)Anthraquinone |
| Molecular Structure | ![]() |
| Molecular Formula | C28H20Cl2N2O2 |
| Molecular Weight | 487.38 |
| CAS Registry Number | 70729-59-8 |
| EINECS | 274-823-0 |
| SMILES | C1=CC(=C3C(=C1NC2=CC=C(C=C2)C)C(C4=C(C3=O)C=C(Cl)C(=C4)Cl)=O)NC5=CC=C(C=C5)C |
| InChI | 1S/C28H20Cl2N2O2/c1-15-3-7-17(8-4-15)31-23-11-12-24(32-18-9-5-16(2)6-10-18)26-25(23)27(33)19-13-21(29)22(30)14-20(19)28(26)34/h3-14,31-32H,1-2H3 |
| InChIKey | UHUSIGIXPSHDGG-UHFFFAOYSA-N |
| Density | 1.402g/cm3 (Cal.) |
|---|---|
| Boiling point | 707.952°C at 760 mmHg (Cal.) |
| Flash point | 381.956°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 6,7-Dichloro-1,4-bis((4-methylphenyl)amino)anthraquinone |