|
CAS#: 71-98-7 Product: Phosphoric Acid O,O-Dipropyl O-(2,2-Dichlorovinyl) Ester No suppilers available for the product. |
| Name | Phosphoric Acid O,O-Dipropyl O-(2,2-Dichlorovinyl) Ester |
|---|---|
| Synonyms | 2,2-Dichlorovinyl Dipropyl Phosphate; Phosphoric Acid 2,2-Dichlorovinyl Dipropyl Ester; Phosphoric Acid, 2,2-Dichlorovinyl Dipropyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C8H15Cl2O4P |
| Molecular Weight | 277.08 |
| CAS Registry Number | 71-98-7 |
| SMILES | C(O[P](=O)(OCCC)OC=C(Cl)Cl)CC |
| InChI | 1S/C8H15Cl2O4P/c1-3-5-12-15(11,13-6-4-2)14-7-8(9)10/h7H,3-6H2,1-2H3 |
| InChIKey | OBUPKOWLJDGPFA-UHFFFAOYSA-N |
| Density | 1.259g/cm3 (Cal.) |
|---|---|
| Boiling point | 258.43°C at 760 mmHg (Cal.) |
| Flash point | 120.314°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Phosphoric Acid O,O-Dipropyl O-(2,2-Dichlorovinyl) Ester |