|
CAS#: 71118-02-0 Product: 15,17-Dihydroxyprogesterone No suppilers available for the product. |
| Name | 15,17-Dihydroxyprogesterone |
|---|---|
| Synonyms | (8R,9S,10R,13S,14S,15R,17R)-17-Ethanoyl-15,17-Dihydroxy-10,13-Dimethyl-2,6,7,8,9,11,12,14,15,16-Decahydro-1H-Cyclopenta[A]Phenanthren-3-One; 15,17-Dihydroxyprogesterone; 15Beta,17Alpha-Dihydroxy-4-Pregnen-3,20-Dione |
| Molecular Structure | ![]() |
| Molecular Formula | C21H30O4 |
| Molecular Weight | 346.47 |
| CAS Registry Number | 71118-02-0 |
| SMILES | [C@H]34[C@H]2[C@@H]([C@@]1(C(=CC(=O)CC1)CC2)C)CC[C@@]3([C@](O)(C[C@H]4O)C(=O)C)C |
| InChI | 1S/C21H30O4/c1-12(22)21(25)11-17(24)18-15-5-4-13-10-14(23)6-8-19(13,2)16(15)7-9-20(18,21)3/h10,15-18,24-25H,4-9,11H2,1-3H3/t15-,16+,17-,18-,19+,20+,21+/m1/s1 |
| InChIKey | FWKZKCGCFQKDQY-KCTPXNJMSA-N |
| Density | 1.22g/cm3 (Cal.) |
|---|---|
| Boiling point | 523.896°C at 760 mmHg (Cal.) |
| Flash point | 284.721°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 15,17-Dihydroxyprogesterone |