|
CAS#: 71230-77-8 Product: 1-(2,5-Dimethoxy-4-Nitrophenyl)Pyrrolidine No suppilers available for the product. |
| Name | 1-(2,5-Dimethoxy-4-Nitrophenyl)Pyrrolidine |
|---|---|
| Synonyms | 1-(2,5-Dimethoxy-4-Nitro-Phenyl)Pyrrolidine; Pyrrolidine, 1-(2,5-Dimethoxy-4-Nitrophenyl)- |
| Molecular Structure | ![]() |
| Molecular Formula | C12H16N2O4 |
| Molecular Weight | 252.27 |
| CAS Registry Number | 71230-77-8 |
| SMILES | C1=C(OC)C(=CC(=C1N2CCCC2)OC)[N+]([O-])=O |
| InChI | 1S/C12H16N2O4/c1-17-11-8-10(14(15)16)12(18-2)7-9(11)13-5-3-4-6-13/h7-8H,3-6H2,1-2H3 |
| InChIKey | NIJNFAKMWFSZLS-UHFFFAOYSA-N |
| Density | 1.238g/cm3 (Cal.) |
|---|---|
| Boiling point | 426.7°C at 760 mmHg (Cal.) |
| Flash point | 211.861°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(2,5-Dimethoxy-4-Nitrophenyl)Pyrrolidine |