|
CAS#: 71436-97-0 Product: Ethyl cyano(1,3,7-trimethyl-2,6-dioxo-2,3,6,7-tetrahydro-1H-purin-8-yl)acetate No suppilers available for the product. |
| Name | Ethyl cyano(1,3,7-trimethyl-2,6-dioxo-2,3,6,7-tetrahydro-1H-purin-8-yl)acetate |
|---|---|
| Synonyms | ethyl α-c |
| Molecular Structure | ![]() |
| Molecular Formula | C13H15N5O4 |
| Molecular Weight | 305.29 |
| CAS Registry Number | 71436-97-0 |
| EINECS | 275-456-9 |
| SMILES | CCOC(=O)C(C#N)c2nc1N(C)C(=O)N(C)C(=O)c1n2C |
| InChI | 1S/C13H15N5O4/c1-5-22-12(20)7(6-14)9-15-10-8(16(9)2)11(19)18(4)13(21)17(10)3/h7H,5H2,1-4H3 |
| InChIKey | BMIKTCIKJATOHU-UHFFFAOYSA-N |
| Density | 1.429g/cm3 (Cal.) |
|---|---|
| Boiling point | 534.641°C at 760 mmHg (Cal.) |
| Flash point | 277.141°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethyl cyano(1,3,7-trimethyl-2,6-dioxo-2,3,6,7-tetrahydro-1H-purin-8-yl)acetate |