|
CAS#: 7147-32-2 Product: (E)-2-(2-Methylpropyl)But-2-Enedioic Acid No suppilers available for the product. |
| Name | (E)-2-(2-Methylpropyl)But-2-Enedioic Acid |
|---|---|
| Synonyms | (E)-2-Isobutylbut-2-Enedioic Acid; Nsc25320 |
| Molecular Structure | ![]() |
| Molecular Formula | C8H12O4 |
| Molecular Weight | 172.18 |
| CAS Registry Number | 7147-32-2 |
| SMILES | C(\C(C(O)=O)=C/C(O)=O)C(C)C |
| InChI | 1S/C8H12O4/c1-5(2)3-6(8(11)12)4-7(9)10/h4-5H,3H2,1-2H3,(H,9,10)(H,11,12)/b6-4+ |
| InChIKey | DBTKYUOIYBJHKK-GQCTYLIASA-N |
| Density | 1.199g/cm3 (Cal.) |
|---|---|
| Boiling point | 340.365°C at 760 mmHg (Cal.) |
| Flash point | 173.848°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (E)-2-(2-Methylpropyl)But-2-Enedioic Acid |