|
CAS#: 71501-26-3 Product: 6-Chloro-4-Methyl-1H-Indole-3-Thiol No suppilers available for the product. |
| Name | 6-Chloro-4-Methyl-1H-Indole-3-Thiol |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C9H8ClNS |
| Molecular Weight | 197.68 |
| CAS Registry Number | 71501-26-3 |
| EINECS | 275-555-7 |
| SMILES | C1=C(S)C2=C([NH]1)C=C(Cl)C=C2C |
| InChI | 1S/C9H8ClNS/c1-5-2-6(10)3-7-9(5)8(12)4-11-7/h2-4,11-12H,1H3 |
| InChIKey | UWWJKBNMJSXSCH-UHFFFAOYSA-N |
| Density | 1.385g/cm3 (Cal.) |
|---|---|
| Boiling point | 373.591°C at 760 mmHg (Cal.) |
| Flash point | 179.741°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-Chloro-4-Methyl-1H-Indole-3-Thiol |