|
CAS#: 71662-24-3 Product: 2,6-Dimethyloct-6-En-2-Yl Formate No suppilers available for the product. |
| Name | 2,6-Dimethyloct-6-En-2-Yl Formate |
|---|---|
| Synonyms | [(E)-1,1,5-Trimethylhept-5-Enyl] Formate; Formic Acid [(E)-1,1,5-Trimethylhept-5-Enyl] Ester; [(E)-2,6-Dimethyloct-6-En-2-Yl] Methanoate |
| Molecular Structure | ![]() |
| Molecular Formula | C11H20O2 |
| Molecular Weight | 184.28 |
| CAS Registry Number | 71662-24-3 |
| EINECS | 275-790-5 |
| SMILES | C(C(OC=O)(C)C)CC\C(=C\C)C |
| InChI | 1S/C11H20O2/c1-5-10(2)7-6-8-11(3,4)13-9-12/h5,9H,6-8H2,1-4H3/b10-5+ |
| InChIKey | UECOUYYXGTZGQB-BJMVGYQFSA-N |
| Density | 0.889g/cm3 (Cal.) |
|---|---|
| Boiling point | 239.254°C at 760 mmHg (Cal.) |
| Flash point | 90.223°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,6-Dimethyloct-6-En-2-Yl Formate |