|
CAS#: 71720-36-0 Product: 2-(2-Methoxyethyl)Pyridine Sulphate No suppilers available for the product. |
| Name | 2-(2-Methoxyethyl)Pyridine Sulphate |
|---|---|
| Synonyms | 2-(2-Methoxyethyl)Pyridine Sulphate |
| Molecular Structure | ![]() |
| Molecular Formula | C8H11NO5S |
| Molecular Weight | 233.24 |
| CAS Registry Number | 71720-36-0 |
| EINECS | 275-884-6 |
| SMILES | O=[S]([O-])([O-])=O.C1=CC=CN=C1CCOC |
| InChI | 1S/C8H11NO.H2O4S/c1-10-7-5-8-4-2-3-6-9-8;1-5(2,3)4/h2-4,6H,5,7H2,1H3;(H2,1,2,3,4)/p-2 |
| InChIKey | PPJICNUNBYNPQZ-UHFFFAOYSA-L |
| Boiling point | 203°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 63.8°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(2-Methoxyethyl)Pyridine Sulphate |