|
CAS#: 71765-50-9 Product: 1-(1H-Indol-3-Yloxoacetyl)-3-Piperidinol No suppilers available for the product. |
| Name | 1-(1H-Indol-3-Yloxoacetyl)-3-Piperidinol |
|---|---|
| Synonyms | 1-(3-Hydroxy-1-Piperidyl)-2-(1H-Indol-3-Yl)Ethane-1,2-Dione; 1-(3-Hydroxy-1-Piperidinyl)-2-(1H-Indol-3-Yl)Ethane-1,2-Dione; 1-(1H-Indol-3-Yloxoacetyl)-3-Piperidinol |
| Molecular Structure | ![]() |
| Molecular Formula | C15H16N2O3 |
| Molecular Weight | 272.30 |
| CAS Registry Number | 71765-50-9 |
| SMILES | C2=C(C(C(N1CC(CCC1)O)=O)=O)C3=C([NH]2)C=CC=C3 |
| InChI | 1S/C15H16N2O3/c18-10-4-3-7-17(9-10)15(20)14(19)12-8-16-13-6-2-1-5-11(12)13/h1-2,5-6,8,10,16,18H,3-4,7,9H2 |
| InChIKey | HRQXLXFKMWLFGA-UHFFFAOYSA-N |
| Density | 1.378g/cm3 (Cal.) |
|---|---|
| Boiling point | 515.253°C at 760 mmHg (Cal.) |
| Flash point | 265.415°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(1H-Indol-3-Yloxoacetyl)-3-Piperidinol |