|
CAS#: 7182-87-8 Product: Dinitrofluoromethane No suppilers available for the product. |
| Name | Dinitrofluoromethane |
|---|---|
| Synonyms | Fluoro-Dinitro-Methane; Fluorodinitromethane; Brn 1817295 |
| Molecular Structure | ![]() |
| Molecular Formula | CHFN2O4 |
| Molecular Weight | 124.03 |
| CAS Registry Number | 7182-87-8 |
| SMILES | O=[N+]([O-])C(F)[N+]([O-])=O |
| InChI | 1S/CHFN2O4/c2-1(3(5)6)4(7)8/h1H |
| InChIKey | UVWILGLWOOQUJD-UHFFFAOYSA-N |
| Density | 1.623g/cm3 (Cal.) |
|---|---|
| Boiling point | 123.016°C at 760 mmHg (Cal.) |
| Flash point | 28.199°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Dinitrofluoromethane |