Online Database of Chemicals from Around the World
|
CAS#: 72018-04-3 Product: 5,5-Dimethyl-2-(2,4,6-Trimethylphenoxy)-1,3,2-Dioxaphosphinane No suppilers available for the product. |
| Name | 5,5-Dimethyl-2-(2,4,6-Trimethylphenoxy)-1,3,2-Dioxaphosphinane |
|---|---|
| Synonyms | 5,5-Dimethyl-2-(2,4,6-Trimethylphenoxy)-1,3,2-Dioxaphosphorinane; 1,3,2-Dioxaphosphorinane, 5,5-Dimethyl-2-(2,4,6-Trimethylphenoxy)- |
| Molecular Structure |  |
| Molecular Formula | C14H21O3P |
| Molecular Weight | 268.29 |
| CAS Registry Number | 72018-04-3 |
| EINECS | 276-295-7 |
| SMILES | C1=C(C(=C(C=C1C)C)OP2OCC(CO2)(C)C)C |
| InChI | 1S/C14H21O3P/c1-10-6-11(2)13(12(3)7-10)17-18-15-8-14(4,5)9-16-18/h6-7H,8-9H2,1-5H3 |
| InChIKey | XEYLUTQJFIWOBO-UHFFFAOYSA-N |
| Boiling point | 300.207°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 163.97°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5,5-Dimethyl-2-(2,4,6-Trimethylphenoxy)-1,3,2-Dioxaphosphinane |