|
CAS#: 72036-55-6 Product: 3-(4-Fluorophenyl)-5,5-Dimethylcyclohex-2-En-1-One No suppilers available for the product. |
| Name | 3-(4-Fluorophenyl)-5,5-Dimethylcyclohex-2-En-1-One |
|---|---|
| Synonyms | 3-(4-Fluorophenyl)-5,5-Dimethyl-Cyclohex-2-En-1-One; 3-(4-Fluorophenyl)-5,5-Dimethyl-1-Cyclohex-2-Enone; 5,5-Dimethyl-3-(4-Fluorophenyl)Cyclohex-2-En-1-One |
| Molecular Structure | ![]() |
| Molecular Formula | C14H15FO |
| Molecular Weight | 218.27 |
| CAS Registry Number | 72036-55-6 |
| SMILES | C2=C(C1=CC(=O)CC(C1)(C)C)C=CC(=C2)F |
| InChI | 1S/C14H15FO/c1-14(2)8-11(7-13(16)9-14)10-3-5-12(15)6-4-10/h3-7H,8-9H2,1-2H3 |
| InChIKey | FTHQUDLJYHQIKT-UHFFFAOYSA-N |
| Density | 1.086g/cm3 (Cal.) |
|---|---|
| Boiling point | 290.204°C at 760 mmHg (Cal.) |
| Flash point | 142.72°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-(4-Fluorophenyl)-5,5-Dimethylcyclohex-2-En-1-One |