|
CAS#: 72072-41-4 Product: N-Acetyl-S-(3-Chloroprop-2-Enyl)Cysteine No suppilers available for the product. |
| Name | N-Acetyl-S-(3-Chloroprop-2-Enyl)Cysteine |
|---|---|
| Synonyms | (2R)-2-Acetamido-3-[(Z)-3-Chloroprop-2-Enyl]Sulfanyl-Propanoic Acid; (2R)-2-Acetamido-3-[[(Z)-3-Chloroprop-2-Enyl]Thio]Propanoic Acid; (2R)-2-Acetamido-3-[[(Z)-3-Chloroprop-2-Enyl]Thio]Propionic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C8H12ClNO3S |
| Molecular Weight | 237.70 |
| CAS Registry Number | 72072-41-4 |
| SMILES | [C@H](C(=O)O)(NC(=O)C)CSC\C=C/Cl |
| InChI | 1S/C8H12ClNO3S/c1-6(11)10-7(8(12)13)5-14-4-2-3-9/h2-3,7H,4-5H2,1H3,(H,10,11)(H,12,13)/b3-2-/t7-/m0/s1 |
| InChIKey | HTIMWNVASRHSBX-XDVGHUOJSA-N |
| Density | 1.317g/cm3 (Cal.) |
|---|---|
| Boiling point | 487.934°C at 760 mmHg (Cal.) |
| Flash point | 248.894°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-Acetyl-S-(3-Chloroprop-2-Enyl)Cysteine |