|
CAS#: 72117-78-3 Product: 3-Methyl-1-Propyl-7H-Purine-2,6-Dione No suppilers available for the product. |
| Name | 3-Methyl-1-Propyl-7H-Purine-2,6-Dione |
|---|---|
| Synonyms | 3-Methyl-1-Propyl-7H-Purine-2,6-Quinone; 1-Mpx; 1-Methyl-3-Propylxanthine |
| Molecular Structure | ![]() |
| Molecular Formula | C9H12N4O2 |
| Molecular Weight | 208.22 |
| CAS Registry Number | 72117-78-3 |
| SMILES | C1=NC2=C([NH]1)C(N(CCC)C(=O)N2C)=O |
| InChI | 1S/C9H12N4O2/c1-3-4-13-8(14)6-7(11-5-10-6)12(2)9(13)15/h5H,3-4H2,1-2H3,(H,10,11) |
| InChIKey | UEGOAAXVUJWIHJ-UHFFFAOYSA-N |
| Density | 1.326g/cm3 (Cal.) |
|---|---|
| Boiling point | 450.732°C at 760 mmHg (Cal.) |
| Flash point | 226.395°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Methyl-1-Propyl-7H-Purine-2,6-Dione |