|
CAS#: 72583-88-1 Product: N-Phenyl-2-Benzofurancarboximidamide No suppilers available for the product. |
| Name | N-Phenyl-2-Benzofurancarboximidamide |
|---|---|
| Synonyms | N'-Phenylbenzofuran-2-Carboxamidine; N'-Phenyl-2-Benzofurancarboxamidine; 2-Benzofurancarboximidamide, N-Phenyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C15H12N2O |
| Molecular Weight | 236.27 |
| CAS Registry Number | 72583-88-1 |
| SMILES | C1=C(OC2=CC=CC=C12)C(=NC3=CC=CC=C3)N |
| InChI | 1S/C15H12N2O/c16-15(17-12-7-2-1-3-8-12)14-10-11-6-4-5-9-13(11)18-14/h1-10H,(H2,16,17) |
| InChIKey | YTZBDAPRURVVOX-UHFFFAOYSA-N |
| Density | 1.202g/cm3 (Cal.) |
|---|---|
| Boiling point | 405.763°C at 760 mmHg (Cal.) |
| Flash point | 199.199°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-Phenyl-2-Benzofurancarboximidamide |