|
CAS#: 72704-20-2 Product: N-(1-Naphthyl)-1,2-ethanediaminium oxalate No suppilers available for the product. |
| Name | N-(1-Naphthyl)-1,2-ethanediaminium oxalate |
|---|---|
| Synonyms | N1-(Naphthalen-1-yl)ethane-1,2-diamine oxalate |
| Molecular Structure | ![]() |
| Molecular Formula | C14H16N2O4 |
| Molecular Weight | 276.29 |
| CAS Registry Number | 72704-20-2 |
| SMILES | [O-]C(=O)C([O-])=O.[NH3+]CC[NH2+]c2cccc1ccccc12 |
| InChI | 1S/C12H14N2.C2H2O4/c13-8-9-14-12-7-3-5-10-4-1-2-6-11(10)12;3-1(4)2(5)6/h1-7,14H,8-9,13H2;(H,3,4)(H,5,6) |
| InChIKey | AWDVHNMBIRJYLK-UHFFFAOYSA-N |
| Boiling point | 578.5°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 303.7°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-(1-Naphthyl)-1,2-ethanediaminium oxalate |