|
CAS#: 7334-12-5 Product: Oxido-(4-Phenylphenyl)-(4-Phenylphenyl)Imino-Azanium No suppilers available for the product. |
| Name | Oxido-(4-Phenylphenyl)-(4-Phenylphenyl)Imino-Azanium |
|---|---|
| Synonyms | Oxido-(4-Phenylphenyl)-(4-Phenylphenyl)Imino-Ammonium; Oxido-(4-Phenylphenyl)-(4-Phenylphenyl)Iminoammonium; Oxido-(4-Phenylphenyl)-(4-Phenylphenyl)Imino-Azanium |
| Molecular Structure | ![]() |
| Molecular Formula | C24H18N2O |
| Molecular Weight | 350.42 |
| CAS Registry Number | 7334-12-5 |
| SMILES | C1=CC(=CC=C1C2=CC=CC=C2)[N+]([N-]C3=CC=C(C=C3)C4=CC=CC=C4)=O |
| InChI | 1S/C24H18N2O/c27-26(24-17-13-22(14-18-24)20-9-5-2-6-10-20)25-23-15-11-21(12-16-23)19-7-3-1-4-8-19/h1-18H |
| InChIKey | YJHCMONWDYRFEN-UHFFFAOYSA-N |
| Density | 1.104g/cm3 (Cal.) |
|---|---|
| Boiling point | 545.913°C at 760 mmHg (Cal.) |
| Flash point | 283.958°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Oxido-(4-Phenylphenyl)-(4-Phenylphenyl)Imino-Azanium |