|
CAS#: 73604-73-6 Product: 1-Methyl-3-(2-propenyl)-3-(2-thienyl)pyrrolidine ethanedioate No suppilers available for the product. |
| Name | 1-Methyl-3-(2-propenyl)-3-(2-thienyl)pyrrolidine ethanedioate |
|---|---|
| Synonyms | 3-Allyl-1-Methyl-3-(2-Thienyl)Pyrrolidine; Oxalic Acid; Ethanedioic Acid; 1-Methyl-3-Prop-2-Enyl-3-Thiophen-2-Yl-Pyrrolidine; 1-Methyl-3-(2-Propenyl)-3-(2-Thienyl)Pyrrolidine Ethanedioate |
| Molecular Structure | ![]() |
| Molecular Formula | C14H19NO4S |
| Molecular Weight | 297.37 |
| CAS Registry Number | 73604-73-6 |
| SMILES | C1=C(SC=C1)C2(CN(CC2)C)CC=C.O=C(O)C(=O)O |
| InChI | 1S/C12H17NS.C2H2O4/c1-3-6-12(7-8-13(2)10-12)11-5-4-9-14-11;3-1(4)2(5)6/h3-5,9H,1,6-8,10H2,2H3;(H,3,4)(H,5,6) |
| InChIKey | APZRUUZINPMLGK-UHFFFAOYSA-N |
| Boiling point | 278.2°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 122°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Methyl-3-(2-propenyl)-3-(2-thienyl)pyrrolidine ethanedioate |