|
CAS#: 73622-97-6 Product: 2-[(4-Bromo-3-Chlorophenyl)Carbamothioylsulfanyl]Acetic Acid No suppilers available for the product. |
| Name | 2-[(4-Bromo-3-Chlorophenyl)Carbamothioylsulfanyl]Acetic Acid |
|---|---|
| Synonyms | 2-[(4-Bromo-3-Chloro-Phenyl)Carbamothioylsulfanyl]Acetic Acid; 2-[[[(4-Bromo-3-Chlorophenyl)Amino]-Thioxomethyl]Thio]Acetic Acid; 2-[(4-Bromo-3-Chloro-Phenyl)Thiocarbamoylthio]Acetic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C9H7BrClNO2S2 |
| Molecular Weight | 340.64 |
| CAS Registry Number | 73622-97-6 |
| SMILES | C1=C(C(=CC=C1NC(SCC(O)=O)=S)Br)Cl |
| InChI | 1S/C9H7BrClNO2S2/c10-6-2-1-5(3-7(6)11)12-9(15)16-4-8(13)14/h1-3H,4H2,(H,12,15)(H,13,14) |
| InChIKey | FCQGJANXKOTFSA-UHFFFAOYSA-N |
| Density | 1.855g/cm3 (Cal.) |
|---|---|
| Boiling point | 460.914°C at 760 mmHg (Cal.) |
| Flash point | 232.553°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-[(4-Bromo-3-Chlorophenyl)Carbamothioylsulfanyl]Acetic Acid |