|
CAS#: 73663-93-1 Product: Ethyl (Z)-3-Phenylsulfinylprop-2-Enoate No suppilers available for the product. |
| Name | Ethyl (Z)-3-Phenylsulfinylprop-2-Enoate |
|---|---|
| Synonyms | (Z)-3-Phenylsulfinylprop-2-Enoic Acid Ethyl Ester; (Z)-3-Phenylsulfinylacrylic Acid Ethyl Ester; 3-(Phenylsulfinyl)Acrylic Acid Ethyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C11H12O3S |
| Molecular Weight | 224.27 |
| CAS Registry Number | 73663-93-1 |
| SMILES | C1=C([S](=O)\C=C/C(OCC)=O)C=CC=C1 |
| InChI | 1S/C11H12O3S/c1-2-14-11(12)8-9-15(13)10-6-4-3-5-7-10/h3-9H,2H2,1H3/b9-8- |
| InChIKey | CSHWPMGIWDFXRH-HJWRWDBZSA-N |
| Density | 1.249g/cm3 (Cal.) |
|---|---|
| Boiling point | 398.96°C at 760 mmHg (Cal.) |
| Flash point | 195.084°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethyl (Z)-3-Phenylsulfinylprop-2-Enoate |