|
CAS#: 73688-91-2 Product: 4-Chloro-1-Nitro-2-[(E)-2-Nitroethenyl]Benzene No suppilers available for the product. |
| Name | 4-Chloro-1-Nitro-2-[(E)-2-Nitroethenyl]Benzene |
|---|---|
| Synonyms | 4-Chloro-1-Nitro-2-[(E)-2-Nitrovinyl]Benzene; Benzene, 4-Chloro-1-Nitro-2-(2-Nitrovinyl)-; Styrene, 5-Chloro-Beta,2-Dinitro- |
| Molecular Structure | ![]() |
| Molecular Formula | C8H5ClN2O4 |
| Molecular Weight | 228.59 |
| CAS Registry Number | 73688-91-2 |
| SMILES | C1=C(C(=CC=C1Cl)[N+](=O)[O-])\C=C\[N+](=O)[O-] |
| InChI | 1S/C8H5ClN2O4/c9-7-1-2-8(11(14)15)6(5-7)3-4-10(12)13/h1-5H/b4-3+ |
| InChIKey | QPOWCZYBXJVQFJ-ONEGZZNKSA-N |
| Density | 1.519g/cm3 (Cal.) |
|---|---|
| Boiling point | 391.61°C at 760 mmHg (Cal.) |
| Flash point | 190.639°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Chloro-1-Nitro-2-[(E)-2-Nitroethenyl]Benzene |