|
CAS#: 73713-82-3 Product: 2,3-Dihydro-3-methyl-2-(4-methylphenoxy)-1,3,2-Benzothiazaphosphole 2-oxide No suppilers available for the product. |
| Name | 2,3-Dihydro-3-methyl-2-(4-methylphenoxy)-1,3,2-Benzothiazaphosphole 2-oxide |
|---|---|
| Synonyms | 1,3,2-Benzothiazaphosphole, 2,3-Dihydro-3-Methyl-2-(4-Methylphenoxy)-, 2-Oxide (9Ci); Nsc 93225; 1,3,2-Benzothiazaphosphole, 2,3-Dihydro-3-Methyl-2-(4-Methylphenoxy)-, 2-Oxide |
| Molecular Structure | ![]() |
| Molecular Formula | C14H14NO2PS |
| Molecular Weight | 291.30 |
| CAS Registry Number | 73713-82-3 |
| SMILES | C2=C1N([P](SC1=CC=C2)(OC3=CC=C(C=C3)C)=O)C |
| InChI | 1S/C14H14NO2PS/c1-11-7-9-12(10-8-11)17-18(16)15(2)13-5-3-4-6-14(13)19-18/h3-10H,1-2H3 |
| InChIKey | LAFKFTRWYOENHB-UHFFFAOYSA-N |
| Density | 1.348g/cm3 (Cal.) |
|---|---|
| Boiling point | 428.733°C at 760 mmHg (Cal.) |
| Flash point | 213.091°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,3-Dihydro-3-methyl-2-(4-methylphenoxy)-1,3,2-Benzothiazaphosphole 2-oxide |