|
CAS#: 73728-61-7 Product: 1-(1-Methylcyclopropyl)-1-(4-Methylphenyl)Ethanol No suppilers available for the product. |
| Name | 1-(1-Methylcyclopropyl)-1-(4-Methylphenyl)Ethanol |
|---|---|
| Synonyms | St5443687; Benzyl Alcohol, Alpha,P-Dimethyl-Alpha-(1-Methylcyclopropyl)-, Dl- |
| Molecular Structure | ![]() |
| Molecular Formula | C13H18O |
| Molecular Weight | 190.28 |
| CAS Registry Number | 73728-61-7 |
| EINECS | 277-577-2 |
| SMILES | C2=C(C(C1(CC1)C)(C)O)C=CC(=C2)C |
| InChI | 1S/C13H18O/c1-10-4-6-11(7-5-10)13(3,14)12(2)8-9-12/h4-7,14H,8-9H2,1-3H3 |
| InChIKey | LSFLKQLAYCHFNX-UHFFFAOYSA-N |
| Density | 1.051g/cm3 (Cal.) |
|---|---|
| Boiling point | 287.139°C at 760 mmHg (Cal.) |
| Flash point | 117.176°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(1-Methylcyclopropyl)-1-(4-Methylphenyl)Ethanol |