|
CAS#: 73728-78-6 Product: 2-Methyl-4-(2,4,6-Trimethylphenyl)Aniline No suppilers available for the product. |
| Name | 2-Methyl-4-(2,4,6-Trimethylphenyl)Aniline |
|---|---|
| Synonyms | [2-Methyl-4-(2,4,6-Trimethylphenyl)Phenyl]Amine; 3,2',4',6'-Tetramethylbiphenylamine; 4-Biphenylamine, 3,2',4',6'-Tetramethyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C16H19N |
| Molecular Weight | 225.33 |
| CAS Registry Number | 73728-78-6 |
| SMILES | C1=C(C(=CC=C1C2=C(C=C(C=C2C)C)C)N)C |
| InChI | 1S/C16H19N/c1-10-7-12(3)16(13(4)8-10)14-5-6-15(17)11(2)9-14/h5-9H,17H2,1-4H3 |
| InChIKey | MLJRKHLRKYVASA-UHFFFAOYSA-N |
| Density | 1.015g/cm3 (Cal.) |
|---|---|
| Boiling point | 324.394°C at 760 mmHg (Cal.) |
| Flash point | 150.988°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Methyl-4-(2,4,6-Trimethylphenyl)Aniline |