Online Database of Chemicals from Around the World
|
CAS#: 73747-36-1 Product: 1,3,7-Trimethyl-8-(3-Methylcyclohexyl)Oxypurine-2,6-Dione No suppilers available for the product. |
| Name | 1,3,7-Trimethyl-8-(3-Methylcyclohexyl)Oxypurine-2,6-Dione |
|---|---|
| Synonyms | 1,3,7-Trimethyl-8-(3-Methylcyclohexoxy)Purine-2,6-Dione; 1,3,7-Trimethyl-8-(3-Methylcyclohexoxy)Xanthine; 1,3,7-Trimethyl-8-(3-Methylcyclohexyl)Oxy-Purine-2,6-Dione |
| Molecular Structure |  |
| Molecular Formula | C15H22N4O3 |
| Molecular Weight | 306.36 |
| CAS Registry Number | 73747-36-1 |
| SMILES | CN3C1=C([N](C(=N1)OC2CC(CCC2)C)C)C(N(C3=O)C)=O |
| InChI | 1S/C15H22N4O3/c1-9-6-5-7-10(8-9)22-14-16-12-11(17(14)2)13(20)19(4)15(21)18(12)3/h9-10H,5-8H2,1-4H3 |
| InChIKey | IIVPOHXPTVEOOE-UHFFFAOYSA-N |
| Density | 1.372g/cm3 (Cal.) |
|---|---|
| Boiling point | 474.021°C at 760 mmHg (Cal.) |
| Flash point | 240.479°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,3,7-Trimethyl-8-(3-Methylcyclohexyl)Oxypurine-2,6-Dione |