Online Database of Chemicals from Around the World
|
CAS#: 73758-26-6 Product: 1,1,1,2,3,3-Hexadeuterio-3-Phenylpropan-2-Amine No suppilers available for the product. |
| Name | 1,1,1,2,3,3-Hexadeuterio-3-Phenylpropan-2-Amine |
|---|---|
| Synonyms | 1,1,1,2,3,3-Hexadeuterio-3-Phenyl-Propan-2-Amine; [1,2,2,2-Tetradeuterio-1-(Dideuterio-Phenyl-Methyl)Ethyl]Amine; Amphetamine-D6 |
| Molecular Structure |  |
| Molecular Formula | C9H7D6N |
| Molecular Weight | 141.25 |
| CAS Registry Number | 73758-26-6 |
| SMILES | C1=C(C(C(N)(C([2H])([2H])[2H])[2H])([2H])[2H])C=CC=C1 |
| InChI | 1S/C9H13N/c1-8(10)7-9-5-3-2-4-6-9/h2-6,8H,7,10H2,1H3/i1D3,7D2,8D |
| InChIKey | KWTSXDURSIMDCE-ZQLKWRTGSA-N |
| Density | 0.989g/cm3 (Cal.) |
|---|---|
| Boiling point | 201.499°C at 760 mmHg (Cal.) |
| Flash point | 87.385°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,1,1,2,3,3-Hexadeuterio-3-Phenylpropan-2-Amine |