|
CAS#: 73758-34-6 Product: 1-Phenyl-2-[3-(Trifluoromethyl)Phenyl]Ethanamine No suppilers available for the product. |
| Name | 1-Phenyl-2-[3-(Trifluoromethyl)Phenyl]Ethanamine |
|---|---|
| Synonyms | [1-Phenyl-2-[3-(Trifluoromethyl)Phenyl]Ethyl]Amine; Brn 2138899; Phenethylamine, Alpha-Phenyl-M-Trifluoromethyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C15H14F3N |
| Molecular Weight | 265.28 |
| CAS Registry Number | 73758-34-6 |
| SMILES | C1=C(C(F)(F)F)C=CC=C1CC(N)C2=CC=CC=C2 |
| InChI | 1S/C15H14F3N/c16-15(17,18)13-8-4-5-11(9-13)10-14(19)12-6-2-1-3-7-12/h1-9,14H,10,19H2 |
| InChIKey | HEGMAOBTPAUJNC-UHFFFAOYSA-N |
| Density | 1.201g/cm3 (Cal.) |
|---|---|
| Boiling point | 302.862°C at 760 mmHg (Cal.) |
| Flash point | 133.326°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Phenyl-2-[3-(Trifluoromethyl)Phenyl]Ethanamine |