|
CAS#: 73771-47-8 Product: 3-(1-Phenylbutyl)-1,3-Oxazolidine Hydrochloride No suppilers available for the product. |
| Name | 3-(1-Phenylbutyl)-1,3-Oxazolidine Hydrochloride |
|---|---|
| Synonyms | 3-(1-Phenylbutyl)Oxazolidine Hydrochloride; H 263; Oxazolidine, 3-(1-Phenylbutyl)-, Hydrochloride |
| Molecular Structure | ![]() |
| Molecular Formula | C13H20ClNO |
| Molecular Weight | 241.76 |
| CAS Registry Number | 73771-47-8 |
| SMILES | [H+].C2=C(C(N1COCC1)CCC)C=CC=C2.[Cl-] |
| InChI | 1S/C13H19NO.ClH/c1-2-6-13(14-9-10-15-11-14)12-7-4-3-5-8-12;/h3-5,7-8,13H,2,6,9-11H2,1H3;1H |
| InChIKey | COYALERAORPIMK-UHFFFAOYSA-N |
| Boiling point | 278.7°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 82°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-(1-Phenylbutyl)-1,3-Oxazolidine Hydrochloride |