|
CAS#: 73791-16-9 Product: 2-Hydroxy-3-Naphthalen-2-Ylchromen-4-One No suppilers available for the product. |
| Name | 2-Hydroxy-3-Naphthalen-2-Ylchromen-4-One |
|---|---|
| Synonyms | 2-Hydroxy-3-(2-Naphthyl)Chromen-4-One; 2-Hydroxy-3-(2-Naphthyl)-4-Chromenone; 2-Hydroxy-3-(2-Naphthyl)Chromone |
| Molecular Structure | ![]() |
| Molecular Formula | C19H12O3 |
| Molecular Weight | 288.30 |
| CAS Registry Number | 73791-16-9 |
| SMILES | C3=C(C2=C(OC1=CC=CC=C1C2=O)O)C=CC4=CC=CC=C34 |
| InChI | 1S/C19H12O3/c20-18-15-7-3-4-8-16(15)22-19(21)17(18)14-10-9-12-5-1-2-6-13(12)11-14/h1-11,21H |
| InChIKey | QXRUIZPXWDPQEJ-UHFFFAOYSA-N |
| Density | 1.384g/cm3 (Cal.) |
|---|---|
| Boiling point | 485.315°C at 760 mmHg (Cal.) |
| Flash point | 181.553°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Hydroxy-3-Naphthalen-2-Ylchromen-4-One |