Online Database of Chemicals from Around the World
|
CAS#: 73855-39-7 Product: 3,6,8-Trichloro-1-Hydroxy-2-(Trichloromethyl)Quinolin-4-One No suppilers available for the product. |
| Name | 3,6,8-Trichloro-1-Hydroxy-2-(Trichloromethyl)Quinolin-4-One |
|---|---|
| Synonyms | 3,6,8-Trichloro-1-Hydroxy-2-(Trichloromethyl)-4-Quinolinone; 3,6,8-Trichloro-1-Hydroxy-2-(Trichloromethyl)-4-Quinolone; 3,6,8-Trichloro-2-(Trichloromethyl)-4-Quinolinol-1-Oxide |
| Molecular Structure |  |
| Molecular Formula | C10H3Cl6NO2 |
| Molecular Weight | 381.86 |
| CAS Registry Number | 73855-39-7 |
| SMILES | C1=C(Cl)C=C(Cl)C2=C1C(=O)C(=C(N2O)C(Cl)(Cl)Cl)Cl |
| InChI | 1S/C10H3Cl6NO2/c11-3-1-4-7(5(12)2-3)17(19)9(10(14,15)16)6(13)8(4)18/h1-2,19H |
| InChIKey | ZUAVEGOLYVBJCG-UHFFFAOYSA-N |
| Density | 1.916g/cm3 (Cal.) |
|---|---|
| Boiling point | 430.232°C at 760 mmHg (Cal.) |
| Flash point | 213.997°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,6,8-Trichloro-1-Hydroxy-2-(Trichloromethyl)Quinolin-4-One |