|
CAS#: 7391-61-9 Product: 5-Ethyl-1,3-Dimethylbarbituric Acid No suppilers available for the product. |
| Name | 5-Ethyl-1,3-Dimethylbarbituric Acid |
|---|---|
| Synonyms | 5-Ethyl-1,3-Dimethyl-Hexahydropyrimidine-2,4,6-Trione; 5-Ethyl-1,3-Dimethylhexahydropyrimidine-2,4,6-Trione; 5-Ethyl-1,3-Dimethyl-Barbituric Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C8H12N2O3 |
| Molecular Weight | 184.19 |
| CAS Registry Number | 7391-61-9 |
| EINECS | 230-980-7 |
| SMILES | C(C1C(N(C(=O)N(C)C1=O)C)=O)C |
| InChI | 1S/C8H12N2O3/c1-4-5-6(11)9(2)8(13)10(3)7(5)12/h5H,4H2,1-3H3 |
| InChIKey | QBCQXNDNMOHQIU-UHFFFAOYSA-N |
| Density | 1.184g/cm3 (Cal.) |
|---|---|
| Boiling point | 253.837°C at 760 mmHg (Cal.) |
| Flash point | 101.279°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-Ethyl-1,3-Dimethylbarbituric Acid |