|
CAS#: 73928-16-2 Product: N-[Dichloro(Dimethylamino)Methyl]Aniline No suppilers available for the product. |
| Name | N-[Dichloro(Dimethylamino)Methyl]Aniline |
|---|---|
| Synonyms | 1,1-Dichloro-N,N-Dimethyl-N'-Phenyl-Methanediamine; [Dichloro-(Phenylamino)Methyl]-Dimethyl-Amine; Brn 2717914 |
| Molecular Structure | ![]() |
| Molecular Formula | C9H12Cl2N2 |
| Molecular Weight | 219.11 |
| CAS Registry Number | 73928-16-2 |
| SMILES | C1=C(NC(N(C)C)(Cl)Cl)C=CC=C1 |
| InChI | 1S/C9H12Cl2N2/c1-13(2)9(10,11)12-8-6-4-3-5-7-8/h3-7,12H,1-2H3 |
| InChIKey | DBSKJJRHWYTCIU-UHFFFAOYSA-N |
| Density | 1.274g/cm3 (Cal.) |
|---|---|
| Boiling point | 282.819°C at 760 mmHg (Cal.) |
| Flash point | 124.845°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-[Dichloro(Dimethylamino)Methyl]Aniline |